A8465432
Diacetoxyscirpenol-13C19 , 25μg/mLinacetonitrile , 2270-40-8
Synonym(s):
12,13-Epoxytrichothec-9-ene-3,4,15-triol-4,15-diacetate solution;4β,15-Diacetoxy-3α-hydroxy-12,13 epoxy-trichothec-9-ene solution;Anguidin solution;DAS
CAS NO.:2270-40-8
Empirical Formula: C19H26O7
Molecular Weight: 366.41
MDL number: MFCD00866334
EINECS: 218-873-3
| Pack Size | Price | Stock | Quantity |
| 1.2ML | RMB10399.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 162-164℃ |
| Boiling point: | 407.62°C (rough estimate) |
| Density | 1.1821 (rough estimate) |
| refractive index | 1.4790 (estimate) |
| Flash point: | 2 °C |
| storage temp. | 2-8°C |
| solubility | DMF: 30 mg/ml; DMF:PBS (pH 7.2) (1:4): 0.2 mg/ml; DMSO: 30 mg/ml; Ethanol: 20 mg/ml |
| form | A crystalline solid |
| pka | 13.40±0.70(Predicted) |
| color | Crystals from EtOAc |
| Major Application | cleaning products cosmetics food and beverages personal care |
| InChI | InChI=1/C19H26O7/c1-10-5-6-18(8-23-11(2)20)13(7-10)26-16-14(22)15(25-12(3)21)17(18,4)19(16)9-24-19/h7,13-16,22H,5-6,8-9H2,1-4H3/t13-,14-,15-,16-,17,18-,19/s3 |
| InChIKey | AUGQEEXBDZWUJY-UYOBWRNGNA-N |
| SMILES | CC12[C@@H]([C@@H](O)[C@@]([H])(O[C@]3([H])C=C(C)CC[C@]13COC(=O)C)C12OC1)OC(=O)C |&1:2,3,5,8,15,r| |
Description and Uses
Diacetoxyscirpenolis is a trichothecene mycotoxin produced by various Fusarium strains. Diacetoxyscirpenol was found to occur in cereals conjugated to glucose and other sugars.
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H300+H310+H330-H315-H319 |
| Precautionary statements | P260-P262-P280 |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | T+,T,Xn,F |
| Risk Statements | 26/27/28-36/38-36-20/21/22-11 |
| Safety Statements | 53-45-36/37-16 |
| RIDADR | UN 3462 6.1/PG 2 |
| WGK Germany | 3 |
| RTECS | YD0112000 |
| F | 10 |
| HazardClass | 6.1(a) |
| PackingGroup | II |
| HS Code | 29329990 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Flam. Liq. 2 |
| Hazardous Substances Data | 2270-40-8(Hazardous Substances Data) |
| Toxicity | LD50 oral in rat: 7mg/kg |




