A6256912
Nivalenol from Fusarium nivale , ≥99.0%(HPLC) , 23282-20-4
Synonym(s):
3α,4β,7α, 15-Tetrahydroxy-12,13-epoxytrichothec-9-en-8-one;NIV;Nivalenol solution
CAS NO.:23282-20-4
Empirical Formula: C15H20O7
Molecular Weight: 312.32
MDL number: MFCD00133673
EINECS: 621-749-5
| Pack Size | Price | Stock | Quantity |
| 1MG | RMB898.40 | In Stock |
|
| 5MG | RMB3711.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 222-223℃ |
| alpha | 24D +21.54° (c = 1.3 in ethanol) |
| Boiling point: | 372.24°C (rough estimate) |
| Density | 1.2307 (rough estimate) |
| refractive index | 1.4790 (estimate) |
| Flash point: | 2 °C |
| storage temp. | 2-8°C |
| solubility | DMF: 30 mg/ml; DMSO: 25 mg/ml; Ethanol: 30 mg/ml; PBS (pH 7.2): 10 mg/ml |
| form | Solid |
| pka | 11.78±0.70(Predicted) |
| color | Crystals from MeOH |
| Major Application | cleaning products cosmetics food and beverages personal care |
| InChI | 1S/C15H20O7/c1-6-3-7-14(4-16,11(20)8(6)17)13(2)10(19)9(18)12(22-7)15(13)5-21-15/h3,7,9-12,16,18-20H,4-5H2,1-2H3/t7-,9-,10-,11-,12-,13-,14-,15+/m1/s1 |
| InChIKey | UKOTXHQERFPCBU-XBXCNEFVSA-N |
| SMILES | [H][C@]12O[C@]3([H])[C@H](O)[C@@H](O)[C@@](C)([C@]34CO4)[C@@]1(CO)[C@H](O)C(=O)C(C)=C2 |
| LogP | -1.558 (est) |
Description and Uses
Nivalenol is a mycotoxin found in wheat and maize which is produced by different Fusarium species that inhibit eukaryotic biosynthesis of protein.Environmental contaminants; Food contaminants
Safety
| Symbol(GHS) | ![]() ![]() GHS02,GHS07 |
| Signal word | Danger |
| Hazard statements | H225-H302+H312+H332-H319 |
| Precautionary statements | P210-P280-P301+P312-P303+P361+P353-P304+P340+P312-P305+P351+P338 |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | T+,Xn,F |
| Risk Statements | 26/27/28-36-20/21/22-11 |
| Safety Statements | 22-36/37/39-45-36/37-26-28-16 |
| RIDADR | UN 2811 6.1/PG 1 |
| WGK Germany | 3 |
| RTECS | YD0165000 |
| HazardClass | 6.1(a) |
| PackingGroup | I |
| HS Code | 38220090 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Flam. Liq. 2 |
| Hazardous Substances Data | 23282-20-4(Hazardous Substances Data) |
| Toxicity | LD50 i.p. in mice: 40 mg/10 g (Tatsuno) |






