A6261212
3-Nitro-1,8-naphthalic anhydride , 90% , 3027-38-1
Synonym(s):
3-Nitronaphthalene-1,8-dicarboxylic anhydride
CAS NO.:3027-38-1
Empirical Formula: C12H5NO5
Molecular Weight: 243.17
MDL number: MFCD00006926
EINECS: 629-274-5
| Pack Size | Price | Stock | Quantity |
| 5G | RMB295.20 | In Stock |
|
| 25G | RMB959.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 247-249 °C (dec.) (lit.) |
| Boiling point: | 386.04°C (rough estimate) |
| Density | 1.4429 (rough estimate) |
| refractive index | 1.4500 (estimate) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | DMSO (Slightly), Methanol (Slightly, Heated, Sonicated) |
| form | Powder |
| color | Light yellow to beige or light brown |
| BRN | 23762 |
| InChI | InChI=1S/C12H5NO5/c14-11-8-3-1-2-6-4-7(13(16)17)5-9(10(6)8)12(15)18-11/h1-5H |
| InChIKey | FLFLZYYDLIKGJQ-UHFFFAOYSA-N |
| SMILES | C1(=O)OC(=O)C2=CC([N+]([O-])=O)=CC3=C2C1=CC=C3 |
| CAS DataBase Reference | 3027-38-1(CAS DataBase Reference) |
Description and Uses
3-Nitro-1,8-naphthalic anhydride is a reagent used to synthesize a monoboronic acid fluorescent sensor that exhibits emission suitable for ratiometric testing and also displays sensitivity for glucose relative to fructose and galactose. 3-Nitro-1,8-naphthalic anhydride is also used as a starting reagent in the synthesis of 5-substituted naphthalimide derivatives which exhibit high anti-cancer activity.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| RTECS | QK5370000 |
| F | 10-21 |
| HazardClass | IRRITANT |
| HS Code | 29163900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |






