A6282912
                    (-)-<i>N</i>,<i>N</i>,<i>N</i>',<i>N</i>'-Tetramethyl-<small>D</small>-tartardiamide , >98.0% , 63126-52-3
                            Synonym(s):
(−)-N,N,N′,N′-Tetramethyl-D -tartaric acid diamide;(−)-D -Tartaric acid bis(dimethylamide);(S,S)-(−)-2,3-Dihydroxy-N,N,N′,N′-tetramethylsuccinamide
                            
                        
                | Pack Size | Price | Stock | Quantity | 
| 5G | RMB225.60 | In Stock | 
                                                 | 
                                        
| 25G | RMB979.20 | In Stock | 
                                                 | 
                                        
| others | Enquire | 
Update time: 2022-07-08
                    PRODUCT Properties
| Melting point: | 186-188 °C (lit.) | 
                                    
| Boiling point: | 342.71°C (rough estimate) | 
                                    
| Density | 1.2441 (rough estimate) | 
                                    
| refractive index | -46 ° (C=3, EtOH) | 
                                    
| storage temp. | Sealed in dry,Room Temperature | 
                                    
| solubility | Chloroform (Slightly), Ethanol (Slightly), Methanol (Slightly) | 
                                    
| form | Solid | 
                                    
| pka | 11.79±0.20(Predicted) | 
                                    
| color | White to Off-White | 
                                    
| optical activity | [α]20/D 46°, c = 3 in ethanol | 
                                    
| BRN | 4675378 | 
                                    
| InChI | InChI=1S/C8H16N2O4/c1-9(2)7(13)5(11)6(12)8(14)10(3)4/h5-6,11-12H,1-4H3/t5-,6-/m0/s1 | 
                                    
| InChIKey | PCYDYHRBODKVEL-WDSKDSINSA-N | 
                                    
| SMILES | C(N(C)C)(=O)[C@@H](O)[C@H](O)C(N(C)C)=O | 
                                    
| CAS DataBase Reference | 63126-52-3 | 
                                    
Description and Uses
N,N,N'',N''-Tetramethyl-D-tartaramide is an intermediate in the synthesis of Diethyl D-(-)-Tartrate (D445045). Diethyl D-(-)-Tartrate is used as a chiral reagent in a host of chemical reactions, suhc as marin toxin and antitumor agent phorboxazole A, or asymmetric syntheses of S,S-dialkyl-substituted sulfoximines.
Safety
| Symbol(GHS) | ![]() GHS07  | 
                                    
| Signal word | Warning | 
| Hazard statements | H302-H315-H319-H335 | 
| Precautionary statements | P261-P305+P351+P338 | 
| Safety Statements | 22-24/25 | 
| WGK Germany | 3 | 
| HS Code | 29241990 | 






