A6282912
(-)-<i>N</i>,<i>N</i>,<i>N</i>',<i>N</i>'-Tetramethyl-<small>D</small>-tartardiamide , >98.0% , 63126-52-3
Synonym(s):
(−)-N,N,N′,N′-Tetramethyl-D -tartaric acid diamide;(−)-D -Tartaric acid bis(dimethylamide);(S,S)-(−)-2,3-Dihydroxy-N,N,N′,N′-tetramethylsuccinamide
| Pack Size | Price | Stock | Quantity |
| 5G | RMB225.60 | In Stock |
|
| 25G | RMB979.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 186-188 °C (lit.) |
| Boiling point: | 342.71°C (rough estimate) |
| Density | 1.2441 (rough estimate) |
| refractive index | -46 ° (C=3, EtOH) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Ethanol (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 11.79±0.20(Predicted) |
| color | White to Off-White |
| optical activity | [α]20/D 46°, c = 3 in ethanol |
| BRN | 4675378 |
| InChI | InChI=1S/C8H16N2O4/c1-9(2)7(13)5(11)6(12)8(14)10(3)4/h5-6,11-12H,1-4H3/t5-,6-/m0/s1 |
| InChIKey | PCYDYHRBODKVEL-WDSKDSINSA-N |
| SMILES | C(N(C)C)(=O)[C@@H](O)[C@H](O)C(N(C)C)=O |
| CAS DataBase Reference | 63126-52-3 |
Description and Uses
N,N,N'',N''-Tetramethyl-D-tartaramide is an intermediate in the synthesis of Diethyl D-(-)-Tartrate (D445045). Diethyl D-(-)-Tartrate is used as a chiral reagent in a host of chemical reactions, suhc as marin toxin and antitumor agent phorboxazole A, or asymmetric syntheses of S,S-dialkyl-substituted sulfoximines.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| HS Code | 29241990 |
| Storage Class | 11 - Combustible Solids |






