BD1190832
2-Butyl-1,3,2-dioxaborolane-4s,5s-dicarboxylicacidbis(dimethylamidE) , 95% , 161344-84-9
Synonym(s):
(4S,5S)-2-Butyl-N,N,N′N′-tetramethyl-1,3,2-dioxaborolane-4,5-dicarboxamide
CAS NO.:161344-84-9
Empirical Formula: C12H23BN2O4
Molecular Weight: 270.13
MDL number: MFCD05663838
| Pack Size | Price | Stock | Quantity |
| 100mg | RMB53.60 | In Stock |
|
| 250mg | RMB66.40 | In Stock |
|
| 1g | RMB152.00 | In Stock |
|
| 5g | RMB628.00 | In Stock |
|
| 10g | RMB1215.20 | In Stock |
|
| 25g | RMB2959.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 305-306 °C (lit.) |
| Density | 1.096 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| pka | -0.81±0.40(Predicted) |
| Appearance | Colorless to light yellow Liquid |
| optical activity | [α]20/D +106°, c = 1% in chloroform |
| InChI | 1S/C12H23BN2O4/c1-6-7-8-13-18-9(11(16)14(2)3)10(19-13)12(17)15(4)5/h9-10H,6-8H2,1-5H3/t9-,10-/m0/s1 |
| InChIKey | AFQWQRBBIZKYTE-UWVGGRQHSA-N |
| SMILES | CCCCB1O[C@@H]([C@H](O1)C(=O)N(C)C)C(=O)N(C)C |
Description and Uses
Butylboronic acid N,N,N′,N′-tetramethyl-D-tartaric acid diamide is a dioxaborolane ligand that can be used to prepare:
- Enantioenriched spiropentanes via zinc catalyzed cyclopropanation of corresponding hydroxymethylallenes.
- 1,2,3-trisubstituted cyclopropane derivatives by asymmetric cyclopropanation of allylic alcohols in the presence of zinc reagents.
- Glycolipids plakosides A, B, and their derivatives by Sharpless asymmetric dihydroxylation and cyclopropanation reaction.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | Eyeshields, Gloves, multi-purpose combination respirator cartridge (US) |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 2933998090 |
| Storage Class | 10 - Combustible liquids |





![2-Butyl-[1,3,2]dioxaborolane-4,5-dicarboxylicacidbis-dimethylamide](https://img.chemicalbook.com/CAS/GIF/161344-85-0.gif)