BD8478847
2-Butyl-[1,3,2]dioxaborolane-4,5-dicarboxylicacidbis-dimethylamide , 95% , 161344-85-0
Synonym(s):
(4R,5R)-2-Butyl-N,N,N′,N′-tetramethyl-1,3,2-dioxaborolane-4,5-dicarboxamide
CAS NO.:161344-85-0
Empirical Formula: C12H23BN2O4
Molecular Weight: 270.13
MDL number: MFCD04038920
| Pack Size | Price | Stock | Quantity |
| 5g | RMB2139.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 178-179 °C(lit.) |
| Density | 1.072 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| pka | -0.81±0.40(Predicted) |
| form | oil |
| color | Yellow |
| optical activity | [α]20/D -105°, c = 1.7% in chloroform |
| InChI | 1S/C12H23BN2O4/c1-6-7-8-13-18-9(11(16)14(2)3)10(19-13)12(17)15(4)5/h9-10H,6-8H2,1-5H3/t9-,10-/m1/s1 |
| InChIKey | AFQWQRBBIZKYTE-NXEZZACHSA-N |
| SMILES | CCCCB1O[C@H]([C@@H](O1)C(=O)N(C)C)C(=O)N(C)C |
| CAS DataBase Reference | 161344-85-0(CAS DataBase Reference) |
Description and Uses
Butylboronic acid?N,N,N′,N′-tetramethyl-L-tartaric acid diamide ester can be used as a cyclopropanation ligand in one of the key steps for the total synthesis of:
- (+)-Frondosin, a natural product from marine sponges.
- Marine cyanobacterium natural products: coibacins A and B.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | Eyeshields, Gloves, multi-purpose combination respirator cartridge (US) |
| Hazard Codes | Xi |
| Safety Statements | 23-24/25 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 2931900090 |
| Storage Class | 10 - Combustible liquids |

![2-Butyl-[1,3,2]dioxaborolane-4,5-dicarboxylicacidbis-dimethylamide](https://img.chemicalbook.com/CAS/GIF/161344-85-0.gif)



