A6286812
<i>N</i>-Succinimidyl 4-Formylbenzoate , >98.0%(HPLC) , 60444-78-2
Synonym(s):
N-Succinimidyl 4-formylbenzoate
| Pack Size | Price | Stock | Quantity |
| 100MG | RMB159.20 | In Stock |
|
| 250mg | RMB250.40 | In Stock |
|
| 1g | RMB576.80 | In Stock |
|
| 5g | RMB2164.80 | In Stock |
|
| 25g | RMB7999.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 163°C |
| Boiling point: | 425.4±47.0 °C(Predicted) |
| Density | 1.44±0.1 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Store in freezer, under -20°C |
| solubility | methanol: soluble50mg/mL, clear to very faintly turbid, colorless |
| form | Solid |
| color | White to Pale Yellow |
| Water Solubility | Water: < 0.1 mg/mL (insoluble) |
| λmax | 274nm(lit.) |
| InChI | InChI=1S/C12H9NO5/c14-7-8-1-3-9(4-2-8)12(17)18-13-10(15)5-6-11(13)16/h1-4,7H,5-6H2 |
| InChIKey | VHYRHFNOWKMCHQ-UHFFFAOYSA-N |
| SMILES | C(ON1C(=O)CCC1=O)(=O)C1=CC=C(C=O)C=C1 |
Description and Uses
Ald-Ph-NHS ester is a nonclaevable linker for antibody-agent-conjugation (ADC).
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| HS Code | 29280000 |




![N-Succinimidyl 4-Nitrophenylacetate [for HPLC Labeling]](https://img.chemicalbook.com/CAS/GIF/68123-33-1.gif)
![2-Amino-4-methoxy-7-(2-deoxy-β-D-ribofuranosyl)-pyrrolo[2,3-d]pyrimidine](https://img.chemicalbook.com/CAS/GIF/150206-15-8.gif)
