A6315412
2'-Nitroacetanilide , >98.0%(GC) , 552-32-9
Synonym(s):
2′-Nitroacetanilide
CAS NO.:552-32-9
Empirical Formula: C8H8N2O3
Molecular Weight: 180.16
MDL number: MFCD00016991
EINECS: 209-009-6
| Pack Size | Price | Stock | Quantity |
| 1g | RMB45.60 | In Stock |
|
| 5g | RMB94.40 | In Stock |
|
| 25G | RMB331.20 | In Stock |
|
| 100g | RMB1119.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 90-94 °C |
| Boiling point: | 312.97°C (rough estimate) |
| Density | 1.42 |
| refractive index | 1.6000 (estimate) |
| storage temp. | Store below +30°C. |
| form | powder to crystal |
| pka | 13.83±0.70(Predicted) |
| color | Light yellow to Yellow to Orange |
| Water Solubility | 2.2g/L(room temperature) |
| Merck | 14,6580 |
| BRN | 1959178 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| InChI | 1S/C8H8N2O3/c1-6(11)9-7-4-2-3-5-8(7)10(12)13/h2-5H,1H3,(H,9,11) |
| InChIKey | BUNFNRVLMKHKIT-UHFFFAOYSA-N |
| SMILES | [N+](=O)([O-])c1c(cccc1)NC(=O)C |
| CAS DataBase Reference | 552-32-9(CAS DataBase Reference) |
| EPA Substance Registry System | Acetamide, N-(2-nitrophenyl)- (552-32-9) |
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 37/39-26-37 |
| WGK Germany | WGK 3 |
| TSCA | TSCA listed |
| HS Code | 29242990 |
| Storage Class | 11 - Combustible Solids |






