A6333412
                    <i>N</i>-Carbobenzoxy-<small>L</small>-2-phenylglycine , >98.0% , 53990-33-3
                            Synonym(s):
Z-L -phenylglycine
                            
                        
                CAS NO.:53990-33-3
Empirical Formula: C16H15NO4
Molecular Weight: 285.3
MDL number: MFCD00077033
EINECS: 1533716-785-6
| Pack Size | Price | Stock | Quantity | 
| 1G | RMB23.20 | In Stock | 
                                                 | 
                                        
| 5G | RMB32.00 | In Stock | 
                                                 | 
                                        
| 25g | RMB89.60 | In Stock | 
                                                 | 
                                        
| 100g | RMB216.00 | In Stock | 
                                                 | 
                                        
| 500g | RMB959.20 | In Stock | 
                                                 | 
                                        
| others | Enquire | 
Update time: 2022-07-08
                    PRODUCT Properties
| Melting point: | 131.0 to 135.0 °C | 
                                    
| Boiling point: | 495.3±45.0 °C(Predicted) | 
                                    
| Density | 1.275±0.06 g/cm3(Predicted) | 
                                    
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature | 
                                    
| solubility | DMSO (Slightly), Ethanol (Slightly) | 
                                    
| form | Solid | 
                                    
| pka | 3.49±0.10(Predicted) | 
                                    
| color | White | 
                                    
| BRN | 4703006 | 
                                    
| InChI | InChI=1/C16H15NO4/c18-15(19)14(13-9-5-2-6-10-13)17-16(20)21-11-12-7-3-1-4-8-12/h1-10,14H,11H2,(H,17,20)(H,18,19)/t14-/s3 | 
                                    
| InChIKey | RLDJWBVOZVJJOS-WDHUHKLTNA-N | 
                                    
| SMILES | [C@H](C1C=CC=CC=1)(C(=O)O)NC(=O)OCC1C=CC=CC=1 |&1:0,r| | 
                                    
| CAS DataBase Reference | 53990-33-3(CAS DataBase Reference) | 
                                    
Description and Uses
Z-L-Phenylglycine is an intermediate for the synthesis of Asimadoline Hydrochlorine (A788250), used in the treatment of IBS, a disorder associated with pain and altered bowel function.
Safety
| Symbol(GHS) | ![]() GHS07  | 
                                    
| Signal word | Warning | 
| Hazard statements | H302-H315-H319-H335 | 
| Precautionary statements | P261-P305+P351+P338 | 
| WGK Germany | 3 | 
| HS Code | 29242990 | 







