A6336012
<i>N</i>-(<i>tert</i>-Butoxycarbonyl)-1<i>H</i>-pyrazole-1-carboxamidine , >98.0%(HPLC) , 152120-61-1
| Pack Size | Price | Stock | Quantity |
| 1G | RMB53.60 | In Stock |
|
| 5G | RMB151.20 | In Stock |
|
| 10g | RMB257.60 | In Stock |
|
| 25G | RMB519.20 | In Stock |
|
| 100g | RMB1520.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 97-101 °C (lit.) |
| Density | 1.21 |
| storage temp. | 2-8°C |
| form | powder to crystal |
| pka | 9.15±0.46(Predicted) |
| color | White to Almost white |
| BRN | 6141956 |
| Major Application | peptide synthesis |
| InChI | 1S/C9H14N4O2/c1-9(2,3)15-8(14)12-7(10)13-6-4-5-11-13/h4-6H,1-3H3,(H2,10,12,14) |
| InChIKey | IGSFMHYSWZUENI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(=N)n1cccn1 |
| CAS DataBase Reference | 152120-61-1 |
Description and Uses
peptide synthesis
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-60-37 |
| WGK Germany | 3 |
| HS Code | 29332900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
