A6366512
4-Nitrobenzaldehyde oxime , 97% , 1129-37-9
Synonym(s):
4-Nitrobenzaldoxime
CAS NO.:1129-37-9
Empirical Formula: C7H6N2O3
Molecular Weight: 166.13
MDL number: MFCD00007377
EINECS: 214-445-5
| Pack Size | Price | Stock | Quantity |
| 1g | RMB103.20 | In Stock |
|
| 5G | RMB319.20 | In Stock |
|
| 25g | RMB1199.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 126-130 °C (lit.)
128-131 °C |
| Boiling point: | 294.32°C (rough estimate) |
| Density | 1.4334 (rough estimate) |
| refractive index | 1.5880 (estimate) |
| storage temp. | Store at room temperature, keep dry and cool |
| pka | 9.97±0.10(Predicted) |
| Appearance | White to off-white Solid |
| BRN | 973581 |
| InChI | 1S/C7H6N2O3/c10-8-5-6-1-3-7(4-2-6)9(11)12/h1-5,10H/b8-5+ |
| InChIKey | WTLPAVBACRIHHC-VMPITWQZSA-N |
| SMILES | [H]\C(=N\O)c1ccc(cc1)[N+]([O-])=O |
| CAS DataBase Reference | 1129-37-9(CAS DataBase Reference) |
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H315-H319-H335-H301 |
| Precautionary statements | P261-P280a-P301+P310a-P305+P351+P338-P405-P501a-P301+P310 |
| PPE | Eyeshields, Faceshields, Gloves, type P2 (EN 143) respirator cartridges |
| Hazard Codes | T,Xi |
| Risk Statements | 25-36/37/38-20 |
| Safety Statements | 36/37/39-45-26-22 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | CU7450000 |
| Hazard Note | Toxic/Irritant |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29280000 |
| Storage Class | 6.1D - Non-combustible acute toxic Cat.3 toxic hazardous materials or hazardous materials causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |




