A6384812
Naphazoline nitrate , 99% , 5144-52-5
Synonym(s):
2-(1-Naphthylmethyl)imidazoline nitrate
CAS NO.:5144-52-5
Empirical Formula: C14H15N3O3
Molecular Weight: 273.29
MDL number: MFCD00014316
EINECS: 225-915-4
| Pack Size | Price | Stock | Quantity |
| 5g | RMB35.20 | In Stock |
|
| 25G | RMB122.40 | In Stock |
|
| 100g | RMB386.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 167-170 °C |
| storage temp. | 2-8°C |
| solubility | Sparingly soluble in water, soluble in ethanol (96 per cent). |
| form | Solid |
| color | White to off-white |
| Sensitive | Hygroscopic |
| BRN | 3779329 |
| Major Application | pharmaceutical (small molecule) |
| InChI | InChI=1S/C14H14N2.HNO3/c1-2-7-13-11(4-1)5-3-6-12(13)10-14-15-8-9-16-14;2-1(3)4/h1-7H,8-10H2,(H,15,16);(H,2,3,4) |
| InChIKey | ZAHXYMFVNNUHCP-UHFFFAOYSA-N |
| SMILES | C12C(C=CC=C1)=CC=CC=2CC1=NCCN1.[N+]([O-])(=O)O |
| CAS DataBase Reference | 5144-52-5(CAS DataBase Reference) |
Description and Uses
antihistamine
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P301+P312+P330 |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| Safety Statements | 22-36/37-60-36 |
| RIDADR | 3249 |
| WGK Germany | 3 |
| RTECS | NJ4376000 |
| F | 3-10 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29332900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |







