A6393112
5-nitrothiophene-2-carbonitrile , 97% , 16689-02-4
Synonym(s):
2-Cyano-5-nitrothiophene
CAS NO.:16689-02-4
Empirical Formula: C5H2N2O2S
Molecular Weight: 154.15
MDL number: MFCD00052401
EINECS: 623-748-5
| Pack Size | Price | Stock | Quantity |
| 1g | RMB40.00 | In Stock |
|
| 5g | RMB104.80 | In Stock |
|
| 10g | RMB232.80 | In Stock |
|
| 25G | RMB332.00 | In Stock |
|
| 100g | RMB1303.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 42-46 °C |
| Boiling point: | 273.9±25.0 °C(Predicted) |
| Density | 1.50±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| Appearance | White to yellow Solid |
| BRN | 123934 |
| InChI | InChI=1S/C5H2N2O2S/c6-3-4-1-2-5(10-4)7(8)9/h1-2H |
| InChIKey | FLYONFCGDKAMIH-UHFFFAOYSA-N |
| SMILES | C1(C#N)SC([N+]([O-])=O)=CC=1 |
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H315-H318-H335 |
| Precautionary statements | P280-P301+P310+P330-P302+P352-P305+P351+P338+P310 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Faceshields, Gloves |
| Hazard Codes | Xn |
| Risk Statements | 22-37/38-41 |
| Safety Statements | 26-36/37/39 |
| RIDADR | UN 3439 6.1/PG 3 |
| WGK Germany | 3 |
| F | 10-13-23 |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29349990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Eye Dam. 1 Skin Irrit. 2 STOT SE 3 |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |






