A6447212
N-t-Butyl 3-aminobenzenesulfonamide , 98% , 608523-94-0
CAS NO.：608523-94-0
Empirical Formula: C10H16N2O2S
Molecular Weight: 228.31
MDL number: MFCD06660528
| Pack Size | Price | Stock | Quantity |
| 1G | RMB183.20 | In Stock |
|
| 5G | RMB639.20 | In Stock |
|
| 25G | RMB2050.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 140 - 142°C |
| Boiling point: | 387.3±44.0 °C(Predicted) |
| Density | 1.189±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | 12.23±0.50(Predicted) |
| form | Solid |
| color | Off-White to Light Yellow |
| InChI | InChI=1S/C10H16N2O2S/c1-10(2,3)12-15(13,14)9-6-4-5-8(11)7-9/h4-7,12H,11H2,1-3H3 |
| InChIKey | KLQVFEHOLLUULE-UHFFFAOYSA-N |
| SMILES | C1(S(NC(C)(C)C)(=O)=O)=CC=CC(N)=C1 |
Description and Uses
3-Amino-N-(Tertbutylbenzenesulfonamide can be used USP30 inhibitors.
Safety
| Symbol(GHS) |   GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H315-H319-H317-H410 |
| Precautionary statements | P501-P261-P273-P272-P264-P280-P302+P352-P391-P337+P313-P305+P351+P338-P362+P364-P333+P313 |
| Hazard Codes | Xi |
| HazardClass | IRRITANT |
