A6475925
3,4-BR>Difluorophenylacetylene , 90% , 143874-13-9
Synonym(s):
4-Ethynyl-1,2-difluorobenzene
| Pack Size | Price | Stock | Quantity |
| 200MG | RMB223.20 | In Stock |
|
| 1G | RMB799.20 | In Stock |
|
| 5g | RMB2799.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 54/2mm |
| Density | 1.144 g/mL at 25 °C |
| refractive index | 1.4902 |
| Flash point: | 7 °C |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | clear liquid |
| color | Colorless to Light yellow |
| InChI | InChI=1S/C8H4F2/c1-2-6-3-4-7(9)8(10)5-6/h1,3-5H |
| InChIKey | XFPAOXIWRDDQGG-UHFFFAOYSA-N |
| SMILES | C1(F)=CC=C(C#C)C=C1F |
Description and Uses
3,4-DIFLUOROPHENYLACETYLENE is a fundamental building block used in organic synthesis for the preparation of metalated and metal-free tetraalkynyl-substituted phthalocyanines, and 3,5-substituted enones etc.
Safety
| Symbol(GHS) | ![]() GHS02 |
| Signal word | Danger |
| Hazard statements | H225 |
| Precautionary statements | P210 |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | F |
| Risk Statements | 11 |
| RIDADR | UN 1993 3/PG 2 |
| WGK Germany | 3 |
| Hazard Note | Flammable |
| HazardClass | 3 |
| HS Code | 2902900000 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Flam. Liq. 2 |
| Limited Quantities | 1.0 L (0.3 gallon) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) |





