BD0719653
5-Ethynyl-1,2,3-trifluorobenzene , 95% , 158816-55-8
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB93.60 | In Stock |
|
| 1g | RMB237.60 | In Stock |
|
| 5g | RMB1172.00 | In Stock |
|
| 10g | RMB1980.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 53-54/1mm |
| Density | 1.27±0.1 g/cm3(Predicted) |
| refractive index | 1.4720 to 1.4760 |
| storage temp. | Store at room temperature |
| form | clear liquid |
| color | Colorless to Light orange to Yellow |
| InChI | InChI=1S/C8H3F3/c1-2-5-3-6(9)8(11)7(10)4-5/h1,3-4H |
| InChIKey | BZXWRVPVZZZAKB-UHFFFAOYSA-N |
| SMILES | C1(F)=CC(C#C)=CC(F)=C1F |
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H227 |
| Precautionary statements | P501-P210-P264-P280-P302+P352-P370+P378-P337+P313-P305+P351+P338-P362+P364-P332+P313-P403+P235 |
| Hazard Codes | Xi,T |
| Risk Statements | 25 |
| Safety Statements | 45 |
| RIDADR | UN 1993 3/PG III |
| WGK Germany | WGK 3 |
| Hazard Note | Irritant |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 2903998090 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |






