A6519912
D-Ornithine monohydrochloride , 98% , 16682-12-5
Synonym(s):
(R)-2,5-Diaminopentanoic acid monohydrochloride
CAS NO.：16682-12-5
Empirical Formula: C5H13ClN2O2
Molecular Weight: 168.62
MDL number: MFCD00012917
EINECS: 240-729-3
| Pack Size | Price | Stock | Quantity |
| 1G | RMB33.60 | In Stock |
|
| 5G | RMB102.40 | In Stock |
|
| 25G | RMB420.80 | In Stock |
|
| 100g | RMB1271.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 239 °C (dec.)(lit.) |
| alpha | [α]D20 -23.0～-24.5゜ (c=4, HCl) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Water (Slightly) |
| form | Solid |
| color | Off-White |
| BRN | 4153339 |
| InChI | InChI=1/C5H12N2O2.ClH/c6-3-1-2-4(7)5(8)9;/h4H,1-3,6-7H2,(H,8,9);1H/t4-;/s3 |
| InChIKey | GGTYBZJRPHEQDG-PGMHMLKASA-N |
| SMILES | [C@@H](N)(CCCN)C(=O)O.Cl |&1:0,r| |
| CAS DataBase Reference | 16682-12-5(CAS DataBase Reference) |
Description and Uses
The D-enatiomer and putative metabolite of the non-essential amino acid L-Orthinine. Stress response studies show intracerebroventricular D-Ornithine Hydrochloride weakly attenuated stress response in neonatal chick under acute stressful condition.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264b-P271-P280-P302+P352-P304+P340-P305+P351+P338-P312-P362+P364-P403+P233-P501c |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| F | 3-10 |
| HS Code | 29224999 |
