BD0449232
D-Lysine , 98% , 923-27-3
Synonym(s):
(R)-2,6-Diaminocaproic acid
CAS NO.:923-27-3
Empirical Formula: C6H14N2O2
Molecular Weight: 146.19
MDL number: MFCD00008234
EINECS: 213-091-9
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB53.60 | In Stock |
|
| 1g | RMB129.60 | In Stock |
|
| 5g | RMB435.20 | In Stock |
|
| 25g | RMB1845.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 218 °C (dec.)(lit.) |
| Boiling point: | 311.5±32.0 °C(Predicted) |
| Density | 1.125±0.06 g/cm3(Predicted) |
| storage temp. | -20°C |
| solubility | H2O: soluble |
| pka | 2.49±0.24(Predicted) |
| form | Solid |
| color | Off-White to Pale Beige |
| optical activity | -25.2493°(C=1.0028g/ml 6N HCL) |
| Water Solubility | H2O: soluble |
| BRN | 1722530 |
| InChI | InChI=1S/C6H14N2O2/c7-4-2-1-3-5(8)6(9)10/h5H,1-4,7-8H2,(H,9,10)/t5-/m1/s1 |
| InChIKey | KDXKERNSBIXSRK-RXMQYKEDSA-N |
| SMILES | C(O)(=O)[C@@H](CCCCN)N |
| LogP | -0.734 (est) |
| CAS DataBase Reference | 923-27-3(CAS DataBase Reference) |
| EPA Substance Registry System | D-Lysine (923-27-3) |
Description and Uses
D-Lysine is used as a component of a wide array of polymers (poly-D-lysine), surfactants and biofilms to confer a positive (cationic) charge.
Safety
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H314 |
| Precautionary statements | P501-P260-P270-P264-P280-P303+P361+P353-P301+P330+P331-P363-P301+P312+P330-P304+P340+P310-P305+P351+P338+P310-P405 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| WGK Germany | 3 |
| HS Code | 29224999 |
| Storage Class | 11 - Combustible Solids |








