A6521212
4,4′-Oxybis(benzoic acid) , 98% , 2215-89-6
Synonym(s):
4,4′-Dicarboxydiphenyl ether
CAS NO.:2215-89-6
Empirical Formula: C14H10O5
Molecular Weight: 258.23
MDL number: MFCD00013988
EINECS: 218-683-0
| Pack Size | Price | Stock | Quantity |
| 25G | RMB71.20 | In Stock |
|
| 100G | RMB213.60 | In Stock |
|
| 250G | RMB495.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 329 °C |
| Boiling point: | 256-259 °C |
| Density | 1.395±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| Water Solubility | Insoluble in water |
| form | powder to crystal |
| pka | 3.94±0.10(Predicted) |
| color | White to Almost white |
| BRN | 2218315 |
| InChI | InChI=1S/C14H10O5/c15-13(16)9-1-5-11(6-2-9)19-12-7-3-10(4-8-12)14(17)18/h1-8H,(H,15,16)(H,17,18) |
| InChIKey | WVDRSXGPQWNUBN-UHFFFAOYSA-N |
| SMILES | O(C1=CC=C(C=C1)C(O)=O)C1=CC=C(C=C1)C(O)=O |
| CAS DataBase Reference | 2215-89-6(CAS DataBase Reference) |
| EPA Substance Registry System | Benzoic acid, 4,4'-oxybis- (2215-89-6) |
Description and Uses
4,4'-oxybisbenzoic acid is a monomeric liquid crystal polymer. it is used widely in the electronics and pharmaceutical industries. Preparation of whole Polyarylate thermoplastic liquid crystal polymer (TLCP), also can be used to prepare high strength, high modulus of liquid crystal fibers, specialty plastics and polymer flame retardants in industrial. also as a non-liquid crystal polymer additives, reduce baking temperature and viscosity of the polymer to facilitate processing and made of an insulating material.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H335-H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HazardClass | IRRITANT |
| HS Code | 29189900 |
| Storage Class | 11 - Combustible Solids |






