A6550512
Oxolinic acid , 98% , 14698-29-4
Synonym(s):
5,8-Dihydro-5-ethyl-8-oxo-1,3-dioxolo[4,5-g]quinoline-7-carboxylic acid
CAS NO.:14698-29-4
Empirical Formula: C13H11NO5
Molecular Weight: 261.23
MDL number: MFCD00056775
EINECS: 238-750-8
| Pack Size | Price | Stock | Quantity |
| 5G | RMB65.60 | In Stock |
|
| 25G | RMB224.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 314-316°C (dec.) |
| Boiling point: | 473℃ |
| Density | 1.3038 (rough estimate) |
| refractive index | 1.5500 (estimate) |
| Flash point: | >110°(230°F) |
| storage temp. | 2-8°C |
| solubility | Soluble in 0.5N NaOH with warming |
| pka | 5.94±0.20(Predicted) |
| form | Crystalline Powder |
| color | White |
| Water Solubility | 3.214mg/L(temperature not stated) |
| Sensitive | Light Sensitive |
| Merck | 13,7014 |
| BRN | 620635 |
| Stability: | Stable. Combustible. |
| Major Application | clinical testing |
| InChI | 1S/C13H11NO5/c1-2-14-5-8(13(16)17)12(15)7-3-10-11(4-9(7)14)19-6-18-10/h3-5H,2,6H2,1H3,(H,16,17) |
| InChIKey | KYGZCKSPAKDVKC-UHFFFAOYSA-N |
| SMILES | CCN1C=C(C(O)=O)C(=O)c2cc3OCOc3cc12 |
| CAS DataBase Reference | 14698-29-4(CAS DataBase Reference) |
| EPA Substance Registry System | Oxolinic acid (14698-29-4) |
Description and Uses
Bacterial DNA gyrase is a heterodimeric type II topoisomerase that negatively supercoils circular double-
Quinolone antibacterial.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264-P270-P301+P312-P501 |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| Safety Statements | 22-24/25-60-36 |
| WGK Germany | 3 |
| RTECS | JI5075000 |
| F | 10 |
| HS Code | 29349990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |
| Hazardous Substances Data | 14698-29-4(Hazardous Substances Data) |
| Toxicity | LD50 in mice, rats (mg/kg): >6000, >2000 orally (Turner) |





