PRODUCT Properties
| Melting point: | 300 °C |
| Boiling point: | 274.55°C (rough estimate) |
| Density | 1.637 |
| refractive index | 1.8500 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Soluble in DMSO. |
| form | Powder |
| pka | pKa 7.7 (Uncertain) |
| color | Light yellow |
| BRN | 139956 |
| Stability: | Hygroscoipic |
| InChI | InChI=1S/C5H4N4O2/c10-4-2-1-6-9-3(2)7-5(11)8-4/h1H,(H3,6,7,8,9,10,11) |
| InChIKey | HXNFUBHNUDHIGC-UHFFFAOYSA-N |
| SMILES | C1(=O)NC(=O)C2C=NNC=2N1 |
| CAS DataBase Reference | 2465-59-0(CAS DataBase Reference) |
| EPA Substance Registry System | Oxypurinol (2465-59-0) |
Description and Uses
Oxypurinol, an allopurinol metabolite, is used as an inhibitor to study the specificity and kinetics of of xanthine oxidase(s). Oxypurinol is also used as an anti-inflammatory agent via inhibition of xanthine oxidase.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 36 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29335990 |
