BD3590145
                    2-((2-Acetamido-6-oxo-1H-purin-9(6H)-yl)methoxy)ethylacetate , 97% , 75128-73-3
                            Synonym(s):
2-{[2-(Acetylamino)-6-oxo-1,6-dihydro-9H-purin-9-yl]methoxy}ethyl acetate;9-[(2-Acetoxyethoxy)methyl]-N2-acetylguanine
                            
                        
                CAS NO.:75128-73-3
Empirical Formula: C12H15N5O5
Molecular Weight: 309.28
MDL number: MFCD00267706
EINECS: 278-077-7
| Pack Size | Price | Stock | Quantity | 
| 1g | RMB24.00 | In Stock | 
                                                 | 
                                        
| 5g | RMB36.00 | In Stock | 
                                                 | 
                                        
| 25g | RMB76.80 | In Stock | 
                                                 | 
                                        
| 100g | RMB225.60 | In Stock | 
                                                 | 
                                        
| 500g | RMB837.60 | In Stock | 
                                                 | 
                                        
| 1000g | RMB1429.60 | In Stock | 
                                                 | 
                                        
| others | Enquire | 
Update time: 2022-07-08
                    PRODUCT Properties
| Melting point: | 204°C | 
                                    
| Density | 1.53 | 
                                    
| storage temp. | 2-8°C | 
                                    
| solubility | DMSO (Slightly), Methanol (Slightly) | 
                                    
| form | Solid | 
                                    
| pka | 8.77±0.20(Predicted) | 
                                    
| color | White to Light Beige | 
                                    
| InChI | InChI=1S/C12H15N5O5/c1-7(18)14-12-15-10-9(11(20)16-12)13-5-17(10)6-21-3-4-22-8(2)19/h5H,3-4,6H2,1-2H3,(H2,14,15,16,18,20) | 
                                    
| InChIKey | VBHLKZHSCMQLTI-UHFFFAOYSA-N | 
                                    
| SMILES | C(NC1NC(=O)C2=C(N=1)N(COCCOC(C)=O)C=N2)(=O)C | 
                                    
| LogP | -0.85 | 
                                    
| CAS DataBase Reference | 75128-73-3(CAS DataBase Reference) | 
                                    
Description and Uses
An impurity of Acyclovir
Safety
| Symbol(GHS) | ![]() GHS07  | 
                                    
| Signal word | Warning | 
| Hazard statements | H315-H319-H335 | 
| Precautionary statements | P261-P305+P351+P338 | 
| Hazard Codes | Xn,Xi | 
| Risk Statements | 20/21/22-36/37/38 | 
| Safety Statements | 26-36-37/39 | 
| HS Code | 2933599550 | 





