A6635412
p-Xylene-d10 , D,98% , 41051-88-1
Synonym(s):
1,4-Dimethylbenzene-d10
CAS NO.：41051-88-1
Empirical Formula: C8D10
Molecular Weight: 116.23
MDL number: MFCD00037699
EINECS: 255-193-6
| Pack Size | Price | Stock | Quantity |
| 1g | RMB239.20 | In Stock |
|
| 5G | RMB879.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 13 °C |
| Boiling point: | 135 °C(lit.) |
| Density | 0.948 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 86 °F |
| storage temp. | Store below +30°C. |
| solubility | 0.2g/l |
| form | Liquid |
| explosive limit | 1.1-7%(V) |
| Water Solubility | Insoluble in water. |
| Sensitive | Moisture Sensitive |
| Merck | 14,10081 |
| InChI | InChI=1S/C8H10/c1-7-3-5-8(2)6-4-7/h3-6H,1-2H3/i1D3,2D3,3D,4D,5D,6D |
| InChIKey | URLKBWYHVLBVBO-ZGYYUIRESA-N |
| SMILES | C([2H])([2H])([2H])C1C([2H])=C([2H])C(=C([2H])C=1[2H])C([2H])([2H])[2H] |
| CAS DataBase Reference | 41051-88-1(CAS DataBase Reference) |
Description and Uses
p-Xylene-d10 may be used as an internal standard (IS) for GC/MS analysis of volatile organic compounds in the emissions from a landfill.
Safety
| Symbol(GHS) |    GHS02,GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H226-H304-H312+H332-H315-H319-H335-H412 |
| Precautionary statements | P210-P273-P280-P301+P310-P303+P361+P353-P331 |
| Hazard Codes | Xn |
| Risk Statements | 10-20/21-38 |
| Safety Statements | 23-36/37 |
| RIDADR | UN 1307 3/PG 3 |
| WGK Germany | 3 |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 28459000 |
