S6252128
m-Xylene-d10 , 98atom%D , 116601-58-2
Synonym(s):
1,3-Dimethylbenzene-d10
| Pack Size | Price | Stock | Quantity |
| 5g | RMB2116.35 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | −48 °C(lit.) |
| Boiling point: | 138-139 °C (lit.) |
| Density | 0.95 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 77 °F |
| solubility | Acetone (Slightly) |
| form | Liquid |
| color | Colourless |
| InChI | 1S/C8H10/c1-7-4-3-5-8(2)6-7/h3-6H,1-2H3/i1D3,2D3,3D,4D,5D,6D |
| InChIKey | IVSZLXZYQVIEFR-ZGYYUIRESA-N |
| SMILES | [2H]c1c([2H])c(c([2H])c(c1[2H])C([2H])([2H])[2H])C([2H])([2H])[2H] |
| CAS Number Unlabeled | 108-38-3 |
Description and Uses
X749417 labeled m-Xylene (X749415) which is an organic solvent used in histology. It is also used after tissue sections have been stained to make them hydrophobic so a coverslip may be applied with a resin in solvent.
Safety
| Symbol(GHS) |   GHS02,GHS07 |
| Signal word | Warning |
| Hazard statements | H226-H312+H332-H315 |
| Precautionary statements | P210-P280-P302+P352+P312-P304+P340+P312 |
| target organs | Respiratory system |
| Hazard Codes | Xn |
| Risk Statements | 10-20/21/22-36/37/38-38-20/21 |
| Safety Statements | 16-26-36-25 |
| RIDADR | UN 1307 3/PG 3 |
| WGK Germany | 3 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Aquatic Chronic 3 Asp. Tox. 1 Eye Dam. 1 Flam. Liq. 3 Skin Irrit. 2 STOT SE 3 |
