A6635812
Phenyl-POSS , 5256-79-1
Synonym(s):
1,3,5,7,9,11,13,15-Octaphenylpentacyclo[9.5.1.13,9.15,15.17,13]octasiloxane;Octaphenyl-POSS;Octaphenylsilsesquioxane
CAS NO.：5256-79-1
Empirical Formula: C48H40O12Si8
Molecular Weight: 1033.51
MDL number: MFCD00308870
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | >350 °C (lit.) |
| Density | 1.30 g/cm3 |
| refractive index | 1.61 |
| storage temp. | Inert atmosphere,Room Temperature |
| form | powder to crystal |
| color | White to Almost white |
| Specific Gravity | 1.35 |
| Hydrolytic Sensitivity | 1: no significant reaction with aqueous systems |
| InChIKey | KBXJHRABGYYAFC-UHFFFAOYSA-N |
| SMILES | O1[Si]2(O[Si]3(O[Si]4(O[Si]1(O[Si]5(O[Si](O2)(O[Si](O3)(O[Si](O4)(O5)c6ccccc6)c7ccccc7)c8ccccc8)c9ccccc9)c%10ccccc%10)c%11ccccc%11)c%12ccccc%12)c%13ccccc%13 |
| CAS DataBase Reference | 5256-79-1 |
| NIST Chemistry Reference | Silsesquioxane, phenyl-, cubical octamer(5256-79-1) |
| EPA Substance Registry System | Pentacyclo[9.5.1.13,9.15,15.17,13]octasiloxane, 1,3,5,7,9,11,13,15-octaphenyl- (5256-79-1) |
Description and Uses
Octaphenylsilsequioxane (CAS# 5256-79-1) is a polyhedral oligomeric silsesquioxane (POSS). Octaphenylsilsequioxane has been used in the preparation of flame-retardant and radiation-resistant materials.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H332-H335 |
| Precautionary statements | P261-P280-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29319000 |
| Storage Class | 11 - Combustible Solids |
