A6683812
L-Phenylalanine methyl ester hydrochloride , 98% , 7524-50-7
CAS NO.：7524-50-7
Empirical Formula: C10H14ClNO2
Molecular Weight: 215.68
MDL number: MFCD00012489
EINECS: 231-383-4
| Pack Size | Price | Stock | Quantity |
| 10G | RMB23.20 | In Stock |
|
| 25G | RMB32.00 | In Stock |
|
| 100G | RMB96.00 | In Stock |
|
| 500G | RMB388.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 158-162 °C(lit.) |
| alpha | 37 º (c=2, C2H5OH) |
| refractive index | 38 ° (C=2, EtOH) |
| storage temp. | -20°C |
| solubility | It is soluble in methanol. (5mg/ ml-clear colorless solution) |
| form | Fine Crystalline Powder |
| color | White to off-white |
| optical activity | [α]20/D +32.4°, c = 2 in ethanol |
| Sensitive | Hygroscopic |
| BRN | 3597948 |
| InChI | InChI=1/C10H13NO2.ClH/c1-13-10(12)9(11)7-8-5-3-2-4-6-8;/h2-6,9H,7,11H2,1H3;1H/t9-;/s3 |
| InChIKey | SWVMLNPDTIFDDY-OVMXBOEKNA-N |
| SMILES | C1(C=CC=CC=1)C[C@H](N)C(=O)OC.Cl |&1:7,r| |
| CAS DataBase Reference | 7524-50-7(CAS DataBase Reference) |
Description and Uses
Methyl L-phenylalaninate hydrochloride is used in pharmaceutical, food,animal feed,cosmetic,bio-chemical research etc.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | Xi,C |
| Risk Statements | 36/37/38-34 |
| Safety Statements | 24/25-45-36/37/39-27-26 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29224995 |
