A6720612
L-Phenylalanine benzyl ester hydrochloride , 98% , 2462-32-0
CAS NO.：2462-32-0
Empirical Formula: C16H18ClNO2
Molecular Weight: 291.77
MDL number: MFCD00043249
EINECS: 219-558-3
| Pack Size | Price | Stock | Quantity |
| 5G | RMB27.20 | In Stock |
|
| 25G | RMB46.40 | In Stock |
|
| 100G | RMB185.60 | In Stock |
|
| 500g | RMB816.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 197-200 °C |
| alpha | -13 º (c=1% in 80% acetic acid) |
| refractive index | -12 ° (C=1, 80% acetic acid) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Soluble[in water] |
| Water Solubility | Soluble in water |
| solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| form | Crystalline Powder |
| color | White to off-white |
| optical activity | [α]20/D 13±1°, c = 1% in acetic acid: water (4:1) |
| BRN | 3919200 |
| InChI | InChI=1/C16H17NO2.ClH/c17-15(11-13-7-3-1-4-8-13)16(18)19-12-14-9-5-2-6-10-14;/h1-10,15H,11-12,17H2;1H/t15-;/s3 |
| InChIKey | CEXFHIYDTRNBJD-AVAJOTNLNA-N |
| SMILES | C1(=CC=CC=C1)C[C@H](N)C(=O)OCC1C=CC=CC=1.Cl |&1:7,r| |
| CAS DataBase Reference | 2462-32-0(CAS DataBase Reference) |
Description and Uses
L-Phenylalanine Benzyl Ester Hydrochloride is a commonly used reactant for the synthesis of L-isoserine derivatives as aminopeptidase N inhibitors and PF-04449913 as a potent and orally bioavailable inhibitor of smoothened.
Safety
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| HS Code | 29224999 |
