A6684012
H-Phe-OEt.HCl , 98% , 3182-93-2
CAS NO.:3182-93-2
Empirical Formula: C11H16ClNO2
Molecular Weight: 229.7
MDL number: MFCD00012507
EINECS: 221-673-9
| Pack Size | Price | Stock | Quantity |
| 5G | RMB24.00 | In Stock |
|
| 10G | RMB45.60 | In Stock |
|
| 25G | RMB61.60 | In Stock |
|
| 100G | RMB183.20 | In Stock |
|
| 500g | RMB752.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 155-156 °C(lit.) |
| alpha | 33.7 º (c=2, C2H5OH 21 ºC) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Methanol, Water |
| form | Fine Needle-Like Crystalline Solid |
| color | White |
| optical activity | [α]20/D 7.8°, c = 2 in H2O |
| Water Solubility | Soluble in methanol and water. |
| Sensitive | Hygroscopic |
| BRN | 3657823 |
| Major Application | peptide synthesis |
| InChI | InChI=1/C11H15NO2.ClH/c1-2-14-11(13)10(12)8-9-6-4-3-5-7-9;/h3-7,10H,2,8,12H2,1H3;1H/t10-;/s3 |
| InChIKey | FPFQPLFYTKMCHN-MEQOOBBNNA-N |
| SMILES | C1(C=CC=CC=1)C[C@H](N)C(=O)OCC.Cl |&1:7,r| |
| CAS DataBase Reference | 3182-93-2(CAS DataBase Reference) |
Description and Uses
L-Phenylalanine Ethyl Ester Hydrochloride is an derivative of L-Phenylalanine (P319415), an essential amino acid.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H319-H335-H302+H312+H332-H315 |
| Precautionary statements | P280-P301+P312-P362+P364 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 22-24/25-26 |
| WGK Germany | 3 |
| HS Code | 29224995 |
| Storage Class | 11 - Combustible Solids |







