A6685212
Pinane, endo + exo , 99% , 473-55-2
CAS NO.:473-55-2
Empirical Formula: C10H18
Molecular Weight: 138.25
MDL number: MFCD00078047
EINECS: 207-467-1
| Pack Size | Price | Stock | Quantity |
| 25G | RMB223.20 | In Stock |
|
| 100G | RMB683.20 | In Stock |
|
| 500g | RMB2079.20 | In Stock |
|
| 2.5kg | RMB6079.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | <25℃ |
| Boiling point: | 169℃ |
| Density | 0.857 g/mL at 20 °C(lit.) |
| refractive index | 1.4662 (589.3 nm 20℃) |
| Flash point: | 48 °C |
| storage temp. | Sealed in dry,2-8°C |
| solubility | 4.73mg/l (calculated) |
| form | liquid |
| color | colorless |
| Odor | Diffusive pine |
| explosive limit | 0.7-7.2%(V) |
| Water Solubility | 1.576mg/L(temperature not stated) |
| BRN | 5237941 |
| Cosmetics Ingredients Functions | PERFUMING |
| InChI | 1S/C10H18/c1-7-4-5-8-6-9(7)10(8,2)3/h7-9H,4-6H2,1-3H3/t7,8-,9-/m1/s1 |
| InChIKey | XOKSLPVRUOBDEW-CFCGPWAMSA-N |
| SMILES | CC1CC[C@@H]2C[C@H]1C2(C)C |
| LogP | 4.686 (est) |
| CAS DataBase Reference | 473-55-2(CAS DataBase Reference) |
| EPA Substance Registry System | Pinane (473-55-2) |
Description and Uses
Pinane is used in preparation method of heat-resistant connecting foam for electronic communication product.
Safety
| Symbol(GHS) | ![]() GHS02 |
| Signal word | Warning |
| Hazard statements | H225-H411 |
| Precautionary statements | P210-P261-P280-P273 |
| Risk Statements | 10 |
| Safety Statements | 16 |
| RIDADR | UN 2319 3/PG 3 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HazardClass | 3 |
| PackingGroup | III |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Aquatic Chronic 2 Flam. Liq. 3 |
| Hazardous Substances Data | 473-55-2(Hazardous Substances Data) |




![(1R,2R,5R)-2-Hydroxy-2,6,6-trimethylbicyclo[3.1.1]heptan-3-one](https://img.chemicalbook.com/CAS/GIF/24047-72-1.gif)

