PRODUCT Properties
| Boiling point: | 160 °C0.8 mm Hg(lit.) |
| Density | 1.196 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| pka | 14.77±0.10(Predicted) |
| form | clear liquid |
| color | Colorless to Light yellow |
| Major Application | peptide synthesis |
| InChI | 1S/C13H17NO3/c15-9-12-7-4-8-14(12)13(16)17-10-11-5-2-1-3-6-11/h1-3,5-6,12,15H,4,7-10H2/t12-/m0/s1 |
| InChIKey | BJTNHGVCFWDNDP-LBPRGKRZSA-N |
| SMILES | OC[C@@H]1CCCN1C(=O)OCc2ccccc2 |
Description and Uses
peptide synthesis
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P301+P312-P302+P352-P304+P340-P305+P351+P338 |
| PPE | Eyeshields, Gloves, multi-purpose combination respirator cartridge (US) |
| WGK Germany | 3 |
| HS Code | 29051990 |
| Storage Class | 10 - Combustible liquids |
