A6769912
1H,1H,2H,2H-Perfluorohexan-1-ol , 98% , 2043-47-2
Synonym(s):
3,3,4,4,5,5,6,6,6-Nonafluoro-1-hexanol
CAS NO.:2043-47-2
Empirical Formula: C6H5F9O
Molecular Weight: 264.09
MDL number: MFCD00039543
EINECS: 218-050-9
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB48.00 | In Stock |
|
| 25G | RMB150.40 | In Stock |
|
| 100G | RMB398.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 140-143 °C (lit.) |
| Density | 1.59 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | 164 °F |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| solubility | Chloroform, Methanol (Slightly) |
| pka | 14.16±0.10(Predicted) |
| form | liquid |
| color | colorless |
| Stability: | Hygroscopic |
| Major Application | PFAS testing |
| InChI | InChI=1S/C6H5F9O/c7-3(8,1-2-16)4(9,10)5(11,12)6(13,14)15/h16H,1-2H2 |
| InChIKey | JCMNMOBHVPONLD-UHFFFAOYSA-N |
| SMILES | C(O)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| CAS DataBase Reference | 2043-47-2(CAS DataBase Reference) |
| EPA Substance Registry System | 1-Hexanol, 3,3,4,4,5,5,6,6,6-nonafluoro- (2043-47-2) |
Description and Uses
1H,1H,2H,2H-Perfluorohexanol is used in the synthesis of polymer coatings with controlled surface topography. As well used in the preparation of star polymers as fluorous nanocapsules for the encapsulation and release of perfluorinated compounds.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H335-H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P321-P332+P313-P362-P264-P280-P305+P351+P338-P337+P313P |
| PPE | Eyeshields, Gloves, multi-purpose combination respirator cartridge (US) |
| Hazard Codes | Xi |
| Safety Statements | 24/25 |
| RIDADR | NA 1993 / PGIII |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| TSCA | TSCA listed |
| HS Code | 29055900 |
| Storage Class | 10 - Combustible liquids |






