A6770512
1H,1H,2H,2H-Perfluorodecanethiol , 97% , 34143-74-3
Synonym(s):
1H,1H,2H,2H-Perfluoro-1-decanethiol;3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-Heptadecafluoro-1-decanethiol
| Pack Size | Price | Stock | Quantity |
| 1G | RMB178.40 | In Stock |
|
| 5G | RMB555.20 | In Stock |
|
| 25G | RMB2200.00 | In Stock |
|
| 100g | RMB6596.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 15 °C |
| Boiling point: | 82 °C |
| Density | 1.678 g/mL at 25 °C |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| form | liquid |
| pka | 9.61±0.10(Predicted) |
| Appearance | Colorless to light yellow Liquid |
| InChI | InChI=1S/C10H5F17S/c11-3(12,1-2-28)4(13,14)5(15,16)6(17,18)7(19,20)8(21,22)9(23,24)10(25,26)27/h28H,1-2H2 |
| InChIKey | URJIJZCEKHSLHA-UHFFFAOYSA-N |
| SMILES | C(S)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| CAS DataBase Reference | 34143-74-3(CAS DataBase Reference) |
| EPA Substance Registry System | 2-(Perfluorooctyl)ethanthiol (34143-74-3) |
Description and Uses
1H, 1H, 2H, 2H-perfluorododecyl mercaptan is a perfluorinated organic substance and can be used as an organic reagent.
Safety
| Symbol(GHS) | ![]() ![]() GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H302+H332-H351-H360D-H362-H372 |
| Precautionary statements | P201-P202-P263-P301+P312-P304+P340+P312-P308+P313 |
| target organs | Liver |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| F | 10-23 |
| Hazard Note | Irritant |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 4 Inhalation Acute Tox. 4 Oral Carc. 2 Eye Dam. 1 Lact. Repr. 1B STOT RE 1 |








