A6773712
3-Phenyl-1H-pyrazole-4-carboxaldehyde , 97% , 26033-20-5
Synonym(s):
3-Phenylpyrazole-4-carbaldehyde
| Pack Size | Price | Stock | Quantity |
| 5G | RMB392.00 | In Stock |
|
| 25G | RMB1558.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 146-148 °C |
| Boiling point: | 302.5°C (rough estimate) |
| Density | 1.1841 (rough estimate) |
| refractive index | 1.7040 (estimate) |
| storage temp. | 2-8°C |
| form | Powder |
| pka | 11.17±0.50(Predicted) |
| color | Light yellow |
| InChI | InChI=1S/C10H8N2O/c13-7-9-6-11-12-10(9)8-4-2-1-3-5-8/h1-7H,(H,11,12) |
| InChIKey | OCCFXKQCKSLEII-UHFFFAOYSA-N |
| SMILES | N1C=C(C=O)C(C2=CC=CC=C2)=N1 |
| CAS DataBase Reference | 26033-20-5(CAS DataBase Reference) |
Description and Uses
3-Phenyl-1H-pyrazole-4-carbaldehyde can be prepared as an corrosion inhibitor for mild steel in hydrochloric acid medium.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P280-P305+P351+P338 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 37/39-26 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29331990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |
| REACH Registrations | Active |







