A6782912
(+)-alpha-Pinene , 99% , 7785-70-8
Synonym(s):
(+)-α-Pinene;(1R,5R)-2,6,6-Trimethylbicyclo[3.1.1]hept-2-ene;(1R,5R)-2-Pinene;(1R)-(+)-α-Pinene;(1R)-2,6,6-Trimethylbicyclo[3.1.1]hept-2-ene
CAS NO.:7785-70-8
Empirical Formula: C10H16
Molecular Weight: 136.23
MDL number: MFCD00001346
EINECS: 232-087-8
| Pack Size | Price | Stock | Quantity |
| 25ML | RMB65.60 | In Stock |
|
| 100ML | RMB148.80 | In Stock |
|
| 500ML | RMB526.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | −62 °C(lit.) |
| Boiling point: | 155-156 °C(lit.) |
| Density | 0.858 g/mL at 20 °C(lit.) |
| vapor pressure | 5 hPa (25 °C) |
| FEMA | 2902 | ALPHA-PINENE |
| refractive index | n |
| Flash point: | 91 °F |
| storage temp. | Store at +2°C to +8°C. |
| form | Liquid |
| color | Clear colorless |
| Odor | at 10.00 % in dipropylene glycol. harsh terpene aromatic minty |
| Odor Type | herbal |
| biological source | synthetic |
| optical activity | [α]22/D +47.1°, neat |
| explosive limit | 0.8-6%(V) |
| Water Solubility | Soluble in Ether, Alcohols, Chloroform. Not miscible in water. |
| Merck | 14,7445 |
| JECFA Number | 1329 |
| BRN | 3648264 |
| Dielectric constant | 2.7(20℃) |
| Major Application | flavors and fragrances |
| InChI | 1S/C10H16/c1-7-4-5-8-6-9(7)10(8,2)3/h4,8-9H,5-6H2,1-3H3/t8-,9-/m1/s1 |
| InChIKey | GRWFGVWFFZKLTI-UHFFFAOYSA-N |
| SMILES | CC1=CC[C@@H]2C[C@H]1C2(C)C |
| LogP | 4.44-4.46 at 20-37℃ |
| CAS DataBase Reference | 7785-70-8(CAS DataBase Reference) |
| EPA Substance Registry System | Bicyclo[3.1.1]hept-2-ene, 2,6,6-trimethyl-, (1R,5R)- (7785-70-8) |
Description and Uses
(1R)-(+)-α-Pinene is used in hydroboration reactions and the reduction of ketones.
Safety
| Symbol(GHS) | ![]() ![]() ![]() ![]() GHS02,GHS07,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H226-H304-H315-H317-H400 |
| Precautionary statements | P210-P273-P280-P301+P310+P331-P302+P352 |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi |
| Risk Statements | 10-36/37/38 |
| Safety Statements | 26-36-16-23 |
| RIDADR | UN 2368 3/PG 3 |
| WGK Germany | 3 |
| RTECS | DT7000000 |
| F | 10 |
| Autoignition Temperature | 491 °F |
| TSCA | TSCA listed |
| HS Code | 2902 19 00 |
| HazardClass | 3 |
| PackingGroup | III |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 Asp. Tox. 1 Flam. Liq. 3 Skin Irrit. 2 Skin Sens. 1 |







![(1R,5R)-4,6,6-Trimethylbicyclo[3.1.1]hept-3-en-2-one](https://img.chemicalbook.com/CAS/GIF/18309-32-5.gif)
