S209279
(+)-α-Longipinene , ≥97.0%(sumofenantiomers,GC) , 5989-08-2
Synonym(s):
(1R,2S,7R,8R)-2,6,6,9-Tetramethyltricyclo[5.4.0.02.8]undec-9-ene
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB1735.12 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 244-246 °C(lit.) |
| Density | 0.915 g/mL at 20 °C(lit.) |
| refractive index | n |
| Flash point: | 92℃ |
| storage temp. | 2-8°C |
| solubility | Chloroform (Slightly), Dichloromethane (Slightly), Methanol (Slightly) |
| form | Oil |
| color | Colourless |
| optical activity | [α]20/D +25±1°, neat |
| Stability: | Light Sensitive |
| InChI | 1S/C15H24/c1-10-6-7-11-13-12(10)15(11,4)9-5-8-14(13,2)3/h6,11-13H,5,7-9H2,1-4H3/t11-,12+,13+,15-/m1/s1 |
| InChIKey | HICYDYJTCDBHMZ-UKTARXLSSA-N |
| SMILES | [H][C@@]12CC=C(C)[C@@]3([H])[C@@]1([H])C(C)(C)CCC[C@]23C |
| LogP | 6.398 (est) |
Description and Uses
(+)-α-Longipinene can be used as a starting material for the synthesis of new terpenoids, (+)-(5S)-5,12-dihydroxy-α-longipinene, (-)-(5R)-5,12-dihydroxy-α-longipinene, and (+)-12-hydroxy-α-longipinen-5-one by oxidation reaction using Aspergillus niger as a biocatalyst. It can be oxidized using lead tetraacetate into tertiary alcohol, longi-cis-verbenol, longi-trans-verbenol, longi-cis-β-crysanthenol, longiverbenone, longi-trans- β -crysanthenol, 2 β,3 β -dihydroxylongipinane, 4 α,8-dihydroxy- α -Iongipinene, and 4 β,8-dihydroxy- α -longipinene.
Safety
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Safety Statements | 23-24/25 |
| RIDADR | NA 1993 / PGIII |
| WGK Germany | 3 |
| Storage Class | 10 - Combustible liquids |



