A6810212
Prednisolone Acetate , Analysis standard , 52-21-1
Synonym(s):
1,4-Pregnadiene-11β,17α,21-triol-3,20-dione 21-acetate;11β,17α,21-Trihydroxy-1,4-pregnadiene-3,20-dione 21-acetate;21-Acetoxy-1,4-pregnadiene-11β,17α-diol-3,20-dione;Prednisolone 21-acetate
CAS NO.:52-21-1
Empirical Formula: C23H30O6
Molecular Weight: 402.49
MDL number: MFCD00037710
EINECS: 200-134-1
| Pack Size | Price | Stock | Quantity |
| 50MG | RMB78.40 | In Stock |
|
| 250MG | RMB262.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 240-244 °C |
| alpha | D25 +116° (dioxane) |
| Boiling point: | 579.8±50.0 °C(Predicted) |
| Density | 1.28±0.1 g/cm3(Predicted) |
| refractive index | 112 ° (C=1, Dioxane) |
| storage temp. | 2-8°C |
| solubility | Practically insoluble in water, slightly soluble in ethanol (96 per cent) and in methylene chloride. |
| form | Solid |
| pka | 12.41±0.70(Predicted) |
| color | White to Off-White |
| Water Solubility | 11.6mg/L(25 ºC) |
| Merck | 7721 |
| BRN | 3111798 |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Major Application | pharmaceutical (small molecule) |
| InChIKey | LRJOMUJRLNCICJ-JZYPGELDSA-N |
| SMILES | [H][C@@]12CCC3=CC(=O)C=C[C@]3(C)[C@@]1([H])[C@@H](O)C[C@@]4(C)[C@@]2([H])CC[C@]4(O)C(=O)COC(C)=O |
| CAS DataBase Reference | 52-21-1(CAS DataBase Reference) |
| NIST Chemistry Reference | 1,4-Pregnadiene-3,20-dione, 11beta,17alpha,21-trihydroxy-, acetate(52-21-1) |
Description and Uses
glucocorticoid
Safety
| Symbol(GHS) | ![]() GHS08 |
| Signal word | Danger |
| Hazard statements | H360FD |
| Precautionary statements | P201-P202-P280-P308+P313-P405-P501 |
| Hazard Codes | N |
| Risk Statements | 25-34-11 |
| Safety Statements | 45-36/37/39-26-16 |
| WGK Germany | 3 |
| RTECS | TU4152500 |
| HS Code | 29372900 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Repr. 1B |




