A6815712
Pirarubicin , ≥97% , 72496-41-4
Synonym(s):
THP
| Pack Size | Price | Stock | Quantity |
| 10MG | RMB355.20 | In Stock |
|
| 50MG | RMB1561.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 188-192°C (dec.) |
| alpha | D25 +175 ±25° (c = 0.2 in CHCl3) |
| Boiling point: | 834.7±65.0 °C(Predicted) |
| Density | 1.51±0.1 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | ethanol: soluble25mg/mL |
| form | powder |
| pka | 7.35±0.60(Predicted) |
| color | Orange to Red |
| Stability: | Hygroscopic |
| InChIKey | KMSKQZKKOZQFFG-YXRRJAAWSA-N |
| SMILES | C1=C(OC)C2C(=O)C3=C(O)C4[C@@H](O[C@@H]5O[C@@H](C)[C@@H](O[C@H]6OCCCC6)[C@@H](N)C5)C[C@](O)(C(CO)=O)CC=4C(O)=C3C(=O)C=2C=C1 |
Description and Uses
Pirarubicin is a new anthracycline anticancer agent structurally related to doxorubicin. In acute leukemia, non-Hodgkin’s lymphoma, breast and ovariail carcinoma, pirarubicin is reportedly superior to doxorubicin and better tolerated. Its major side-effect appears to be myelosuppression, mainly in the form of leucopenia, which is potentially dose-limiting.
Structural analog of Doxorubicin. Antineoplastic.
Safety
| Symbol(GHS) |  GHS08 |
| Signal word | Danger |
| Hazard statements | H340-H350-H360FD |
| Precautionary statements | P201-P202-P280-P308+P313-P405-P501 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| RTECS | QI9296000 |
| Toxicity | LD50 i.v. in mice: 27.8 mg/kg (Umezawa, 1979) |
