A6855212
Pretilachlor , 95% , 51218-49-6
Synonym(s):
2-Chloro-2′,6′-diethyl-N-(2-propoxyethyl)acetanilide
| Pack Size | Price | Stock | Quantity |
| 1G | RMB958.40 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 25°C |
| Boiling point: | bp0.001 135° |
| Density | 1.0521 (rough estimate) |
| refractive index | nD20 1.5204 |
| storage temp. | Inert atmosphere,2-8°C |
| Water Solubility | Insoluble in water |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Liquid
(Density: 1.074±0.06 g/cm3) |
| pka | 1.41±0.50(Predicted) |
| Specific Gravity | 1.076 (20℃) |
| color | Light yellow to Brown |
| Merck | 14,7740 |
| BRN | 2754162 |
| Major Application | agriculture environmental |
| InChI | 1S/C17H26ClNO2/c1-4-11-21-12-10-19(16(20)13-18)17-14(5-2)8-7-9-15(17)6-3/h7-9H,4-6,10-13H2,1-3H3 |
| InChIKey | YLPGTOIOYRQOHV-UHFFFAOYSA-N |
| SMILES | CCCOCCN(C(=O)CCl)c1c(CC)cccc1CC |
| CAS DataBase Reference | 51218-49-6(CAS DataBase Reference) |
| NIST Chemistry Reference | Pretilachlor(51218-49-6) |
Description and Uses
Pretilachlor is a chloroacetanalide herbicide. Pretilachlor is commonly used for weed control in wet seeded rice
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H315-H331 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P304+P340+P311 |
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi;N,N,Xi |
| Risk Statements | 38-50/53 |
| Safety Statements | 60-61 |
| RIDADR | UN 3082 9/PG 3 |
| WGK Germany | 2 |
| RTECS | AB5427000 |
| HazardClass | 9 |
| PackingGroup | III |
| HS Code | 29242990 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Inhalation Skin Irrit. 2 |
| Toxicity | LD50 in rats (mg/kg): 6099 orally; >3100 dermally (Rufener, Quadranti); LC50 in rainbow trout, carp, catfish: 3.0, 3.0, 2.6 ppm (Vogel, Aebi) |





