A6884412
4-Phthalimidobutyric Acid , >97.0%(HPLC) , 3130-75-4
CAS NO.：3130-75-4
Empirical Formula: C12H11NO4
Molecular Weight: 233.22
MDL number: MFCD00196079
EINECS: 200-589-5
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB255.20 | In Stock |
|
| 1G | RMB497.60 | In Stock |
|
| 5G | RMB1175.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 119-121°C |
| Boiling point: | 442.1±28.0 °C(Predicted) |
| Density | 1.389 |
| storage temp. | -20°C Freezer, Under inert atmosphere |
| solubility | Chloroform (Slightly), DMSO (Slightly) |
| pka | 4.63±0.10(Predicted) |
| form | Solid |
| color | White to Off-White |
| λmax | 290nm(EtOH)(lit.) |
| InChI | InChI=1S/C12H11NO4/c14-10(15)6-3-7-13-11(16)8-4-1-2-5-9(8)12(13)17/h1-2,4-5H,3,6-7H2,(H,14,15) |
| InChIKey | HMKSXJBFBVGLJJ-UHFFFAOYSA-N |
| SMILES | C1(=O)C2=C(C=CC=C2)C(=O)N1CCCC(O)=O |
| CAS DataBase Reference | 3130-75-4(CAS DataBase Reference) |
Description and Uses
4-Phthalimidobutyric Acid can be used to evaluate nootropicactivity of newly synthesized gaba derivative in mice.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 |
| Hazard Codes | Xi |
| RTECS | NR3459000 |
| HazardClass | IRRITANT |
| HS Code | 2933599590 |
