BD2677248
(S)-2-(1,3-Dioxoisoindolin-2-yl)pentanedioicacid , 98% , 340-90-9
Synonym(s):
PhGA
| Pack Size | Price | Stock | Quantity |
| 1g | RMB28.00 | In Stock |
|
| 5g | RMB96.00 | In Stock |
|
| 25g | RMB325.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 160-162 °C(lit.) |
| alpha | -45°(20/D, c=1, C2H5OH) |
| Boiling point: | 519.0±40.0 °C(Predicted) |
| Density | 1.566±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 3.45±0.10(Predicted) |
| form | Powder |
| Appearance | White to off-white Solid |
| optical activity | [α]20/D 45°, c = 1 in ethanol |
| BRN | 90136 |
| Major Application | peptide synthesis |
| InChI | InChI=1S/C13H11NO6/c15-10(16)6-5-9(13(19)20)14-11(17)7-3-1-2-4-8(7)12(14)18/h1-4,9H,5-6H2,(H,15,16)(H,19,20)/t9-/m0/s1 |
| InChIKey | FEFFSKLJNYRHQN-VIFPVBQESA-N |
| SMILES | C(O)(=O)[C@@H](N1C(=O)C2=C(C1=O)C=CC=C2)CCC(O)=O |
| LogP | -4.2-0.9 at 20℃ and pH1-7 |
| Surface tension | 72.4mN/m at 1g/L and 20℃ |
| CAS DataBase Reference | 340-90-9(CAS DataBase Reference) |
Description and Uses
peptide synthesis
Safety
| Symbol(GHS) | ![]() GHS05 |
| Signal word | Danger |
| Hazard statements | H318 |
| Precautionary statements | P280-P305+P351+P338-P310 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Safety Statements | 22-24/25 |
| WGK Germany | 3 |
| RTECS | MA3820000 |
| Storage Class | 11 - Combustible Solids |






