BD7606231
2-Isopropylisoindoline-1,3-dione , 97% , 304-17-6
CAS NO.:304-17-6
Empirical Formula: C11H11NO2
Molecular Weight: 189.21
MDL number: MFCD00014582
EINECS: 206-150-5
| Pack Size | Price | Stock | Quantity |
| 5g | RMB130.40 | In Stock |
|
| 25g | RMB484.80 | In Stock |
|
| 100g | RMB1600.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 82-84°C |
| Boiling point: | 273°C(lit.) |
| Density | 1.1596 (rough estimate) |
| refractive index | 1.5012 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | -2.15±0.20(Predicted) |
| color | White to Almost white |
| Cosmetics Ingredients Functions | SOLVENT PLASTICISER SKIN CONDITIONING |
| InChI | InChI=1S/C11H11NO2/c1-7(2)12-10(13)8-5-3-4-6-9(8)11(12)14/h3-7H,1-2H3 |
| InChIKey | VPLDXHDOGVIETL-UHFFFAOYSA-N |
| SMILES | C1(=O)C2=C(C=CC=C2)C(=O)N1C(C)C |
| CAS DataBase Reference | 304-17-6(CAS DataBase Reference) |
| EPA Substance Registry System | 1H-Isoindole-1,3(2H)-dione, 2-(1-methylethyl)- (304-17-6) |
Description and Uses
N-Isopropylphthalimide can be used as a pesticide intermediate.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264-P270-P301+P312+P330-P501 |
| RTECS | TI5425000 |
| TSCA | TSCA listed |
| HS Code | 2933998090 |







