A6265012
4-Nitrophthalimide , >98.0%(HPLC) , 89-40-7
CAS NO.:89-40-7
Empirical Formula: C8H4N2O4
Molecular Weight: 192.13
MDL number: MFCD00005884
EINECS: 201-905-5
| Pack Size | Price | Stock | Quantity |
| 5g | RMB23.20 | In Stock |
|
| 25G | RMB61.60 | In Stock |
|
| 100G | RMB179.20 | In Stock |
|
| 250g | RMB255.20 | In Stock |
|
| 500G | RMB524.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 206 °C |
| Boiling point: | 328.09°C (rough estimate) |
| Density | 1.5513 (rough estimate) |
| refractive index | 1.4900 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | 7.79±0.20(Predicted) |
| color | Yellow powder |
| Water Solubility | <0.01 g/100 mL at 18 ºC |
| BRN | 180224 |
| Stability: | Stable. Combustible. Incompatible with moisture, water, strong oxidising agents, strong bases. |
| Major Application | diagnostic assay manufacturing hematology histology |
| InChI | 1S/C8H4N2O4/c11-7-5-2-1-4(10(13)14)3-6(5)8(12)9-7/h1-3H,(H,9,11,12) |
| InChIKey | ANYWGXDASKQYAD-UHFFFAOYSA-N |
| SMILES | [O-][N+](=O)c1ccc2C(=O)NC(=O)c2c1 |
| CAS DataBase Reference | 89-40-7(CAS DataBase Reference) |
| NIST Chemistry Reference | 4-Nitro-phthalimide(89-40-7) |
| EPA Substance Registry System | 4-Nitrophthalimide (89-40-7) |
Description and Uses
4-Nitrophthalimide is used as intermediate of organic synthesis and fluorescent dyes, it can be used to produce azo dyes, luminol, etc. It can also be used to prepare 4-nitrophthalonitrile, 5-cyanophthalide and other drug intermediates.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 37/39-26-36-24/25 |
| WGK Germany | 3 |
| RTECS | TI5625000 |
| Hazard Note | Irritant |
| TSCA | TSCA listed |
| HS Code | 29251900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Toxicity | mmo-sat 333 mg/plate EMMUEG 11(Suppl 12),1,88 |






