A6263712
3-Nitrophthalimide , >97.0% , 603-62-3
CAS NO.：603-62-3
Empirical Formula: C8H4N2O4
Molecular Weight: 192.13
MDL number: MFCD00041852
EINECS: 210-051-2
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 25G | RMB47.20 | In Stock |
|
| 100G | RMB87.20 | In Stock |
|
| 500g | RMB247.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 213-215 °C(lit.) |
| Boiling point: | 328.09°C (rough estimate) |
| Density | 1.5513 (rough estimate) |
| refractive index | 1.4900 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| form | Crystalline Powder |
| pka | 8.13±0.20(Predicted) |
| color | Yellow to straw-yellow |
| Water Solubility | Insoluble in water. |
| BRN | 179965 |
| InChI | InChI=1S/C8H4N2O4/c11-7-4-2-1-3-5(10(13)14)6(4)8(12)9-7/h1-3H,(H,9,11,12) |
| InChIKey | BONIIQYTWOPUQI-UHFFFAOYSA-N |
| SMILES | C1(=O)C2=C(C([N+]([O-])=O)=CC=C2)C(=O)N1 |
| CAS DataBase Reference | 603-62-3(CAS DataBase Reference) |
| EPA Substance Registry System | 1H-Isoindole-1,3(2H)-dione, 4-nitro- (603-62-3) |
Description and Uses
3-Nitrophthalimide is a nitro heterocyclic compounds found to exhibit potential antifungal activities. Dyes and metabolites.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39-24/25 |
| WGK Germany | 3 |
| TSCA | Yes |
| HS Code | 29251900 |
