A6902712
2',3',4',5',6'-Pentafluoroacetophenone , >98.0%(GC) , 652-29-9
CAS NO.:652-29-9
Empirical Formula: C8H3F5O
Molecular Weight: 210.1
MDL number: MFCD00000296
EINECS: 211-487-6
| Pack Size | Price | Stock | Quantity |
| 1G | RMB111.20 | In Stock |
|
| 5G | RMB395.20 | In Stock |
|
| 25G | RMB1163.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 130.5 °C |
| Boiling point: | 130-131 °C(lit.) |
| Density | 1.476 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 150 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| form | clear liquid |
| color | Colorless to Light yellow to Light orange |
| Specific Gravity | 1.476 |
| BRN | 2053225 |
| InChI | 1S/C8H3F5O/c1-2(14)3-4(9)6(11)8(13)7(12)5(3)10/h1H3 |
| InChIKey | FBGHCYZBCMDEOX-UHFFFAOYSA-N |
| SMILES | CC(=O)c1c(F)c(F)c(F)c(F)c1F |
| CAS DataBase Reference | 652-29-9(CAS DataBase Reference) |
Description and Uses
2′,3′,4′,5′,6′-Pentafluoroacetophenone was used in asymmetric synthesis of chiral alcohols using ketoreductase isolated from cyanobacterium Synechococcus sp. strain PCC 7942. It was also used in the synthesis of benzalpentafluoroacetophenone and 2,3-dihydryl-F-benzalacetophenone.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H227-H315-H319-H335 |
| Precautionary statements | P210-P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P403+P235-P501-P210e-P261-P280a-P305+P351+P338-P405-P501a |
| PPE | Eyeshields, Gloves, type ABEK (EN14387) respirator filter |
| Hazard Codes | F |
| Risk Statements | 36/37/38 |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| Hazard Note | Flammable |
| HS Code | 29147000 |
| Storage Class | 10 - Combustible liquids |







