A6912912
1-Pyrenecarboxylic Acid , 97% , 19694-02-1
| Pack Size | Price | Stock | Quantity |
| 100MG | RMB86.40 | In Stock |
|
| 1G | RMB361.60 | In Stock |
|
| 5G | RMB916.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 270-272 °C (lit.) |
| Boiling point: | 329.26°C (rough estimate) |
| Density | 1.2132 (rough estimate) |
| refractive index | 1.4770 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMF: soluble |
| form | powder to crystal |
| pka | 3.49±0.30(Predicted) |
| color | Light yellow to Yellow to Green |
| BRN | 2375854 |
| InChI | InChI=1S/C17H10O2/c18-17(19)14-9-7-12-5-4-10-2-1-3-11-6-8-13(14)16(12)15(10)11/h1-9H,(H,18,19) |
| InChIKey | HYISVWRHTUCNCS-UHFFFAOYSA-N |
| SMILES | C1(C(O)=O)=C2C3=C4C(C=C2)=CC=CC4=CC=C3C=C1 |
Description and Uses
PCA can be used in the surface modification of graphene and carbon nanotubes (CNTs), which can further be used for a variety of electronic applications.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| WGK Germany | 3 |
| F | 8 |
| HS Code | 29163990 |
| Storage Class | 11 - Combustible Solids |




