PRODUCT Properties
| Melting point: | 159-160 °C (lit.) |
| Boiling point: | 312.08°C (rough estimate) |
| Density | 1.1035 (rough estimate) |
| refractive index | 1.6000 (estimate) |
| storage temp. | 2-8°C |
| solubility | DMSO: soluble50mg/mL, clear, colorless to yellow |
| pka | 4.29±0.10(Predicted) |
| form | Powder |
| color | Beige |
| Water Solubility | 39.27mg/L(25 ºC) |
| Merck | 14,3316 |
| BRN | 1211592 |
| InChI | InChI=1S/C14H12O2/c15-14(16)10-11-6-8-13(9-7-11)12-4-2-1-3-5-12/h1-9H,10H2,(H,15,16) |
| InChIKey | QRZAKQDHEVVFRX-UHFFFAOYSA-N |
| SMILES | C1(C2=CC=CC=C2)=CC=C(CC(O)=O)C=C1 |
| CAS DataBase Reference | 5728-52-9(CAS DataBase Reference) |
Description and Uses
Felbinac Is the active metabolite of the non-steroidal antiinflammatory agent, fenbufen. Applied topically as a gel to joints, it is useful in the symptomatic relief of articular inflammation and pain.
Anti-inflammatory, analgesic drug.
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H301+H331-H315-H319-H335 |
| Precautionary statements | P261-P264-P301+P310-P302+P352-P304+P340+P311-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | Eyeshields, Faceshields, Gloves, type P2 (EN 143) respirator cartridges |
| Hazard Codes | T,Xn |
| Risk Statements | 23/25-36/37/38-25-36/37/38/63-20/21/22 |
| Safety Statements | 26-36/37/39-45-37/39-28A-26/36/3745/60-20-36 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | DU8229050 |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29163900 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Inhalation Acute Tox. 3 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Toxicity | LD50 orally in rats: 164 mg/kg (Sloboda, Osterberg) |
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) |
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) |




