A6962712
Pterine , ~95% , 2236-60-4
Synonym(s):
2-Amino-4-hydroxypteridine;2-Amino-4-oxodihydropteridine
CAS NO.:2236-60-4
Empirical Formula: C6H5N5O
Molecular Weight: 163.14
MDL number: MFCD00010557
EINECS: 218-799-1
| Pack Size | Price | Stock | Quantity |
| 50MG | RMB295.20 | In Stock |
|
| 250MG | RMB507.20 | In Stock |
|
| 1G | RMB1276.80 | In Stock |
|
| 5g | RMB4799.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 300 °C |
| Boiling point: | 290.2°C (rough estimate) |
| Density | 1.4240 (rough estimate) |
| refractive index | 1.9000 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,2-8°C |
| solubility | Acetonitrile: Soluble Water: Soluble |
| form | powder |
| pka | 2.27(at 20℃) |
| biological source | synthetic |
| Water Solubility | 17.54mg/L(22.5 ºC) |
| BRN | 150294 |
| InChI | InChI=1S/C6H5N5O/c7-6-10-4-3(5(12)11-6)8-1-2-9-4/h1-2H,(H3,7,9,10,11,12) |
| InChIKey | HNXQXTQTPAJEJL-UHFFFAOYSA-N |
| SMILES | N1C2C(=NC=CN=2)C(=O)NC=1N |
| CAS DataBase Reference | 2236-60-4(CAS DataBase Reference) |
| NIST Chemistry Reference | 4(1H)-pteridinone, 2-amino-(2236-60-4) |
Description and Uses
Pterin is used in the biosynthesis and metabolism of tetrahydrobiopterin and molybdopterin.
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| target organs | Respiratory system |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| RTECS | UO3505000 |
| F | 10-23 |
| HS Code | 29335990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |




![N-[4-[[(2-Amino-3,4-dihydro-4-oxo-6-pteridinyl)methyl]formylamino]benzoyl]-L-glutamic acid](https://img.chemicalbook.com/CAS/GIF/134-05-4.gif)


