PRODUCT Properties
Melting point: | 194-195 °C(lit.) |
Boiling point: | 179.65°C (rough estimate) |
Density | 1.1712 (rough estimate) |
refractive index | 1.4434 (estimate) |
storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
form | Crystalline Powder |
pka | 3.57±0.25(Predicted) |
color | Yellow-beige |
BRN | 1722246 |
InChI | InChI=1S/C6H6O4/c7-5(8)3-1-2-4-6(9)10/h1-4H,(H,7,8)(H,9,10)/b3-1-,4-2- |
InChIKey | TXXHDPDFNKHHGW-CCAGOZQPSA-N |
SMILES | C(O)(=O)/C=C\C=C/C(O)=O |
CAS DataBase Reference | 1119-72-8 |
Description and Uses
cis,cis-Muconic acid, a metabolic intermediate of Klebsiella pneumonia, can be converted to adipic acid and terephthalic acid, which are important monomers of synthetic polymers. cis,cis-Muconic acid is also a biochemical material that can be used for the production of various plastics and polymers and is particularly gaining attention as an adipic acid precursor for the synthesis of nylon-6,6[1][2].
Safety
Symbol(GHS) | ![]() GHS07 |
Signal word | Warning |
Hazard statements | H302-H315-H319-H335 |
Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
Hazard Codes | Xn |
Risk Statements | 22-36/37/38 |
Safety Statements | 26 |
WGK Germany | 3 |
F | 10-23 |
HS Code | 29171990 |