A6987658
B-hydroxyethyltheophylline , 10mMinDMSO , 519-37-9
Synonym(s):
1,3-Dimethyl-7-(2-hydroxyethyl)xanthine;7-(β-Hydroxyethyl)theophylline
CAS NO.:519-37-9
Empirical Formula: C9H12N4O3
Molecular Weight: 224.22
MDL number: MFCD00055055
EINECS: 208-269-8
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB239.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 163°C |
| Boiling point: | 365.61°C (rough estimate) |
| Density | 1.3055 (rough estimate) |
| refractive index | 1.6300 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | H2O: Solutions may be stored for several days at 4°C.soluble |
| pka | 14.48±0.10(Predicted) |
| form | solid |
| color | white |
| Water Solubility | 2.991g/L(temperature not stated) |
| Merck | 14,3878 |
| InChI | 1S/C9H12N4O3/c1-11-7-6(8(15)12(2)9(11)16)13(3-4-14)5-10-7/h5,14H,3-4H2,1-2H3 |
| InChIKey | NWPRCRWQMGIBOT-UHFFFAOYSA-N |
| SMILES | CN1C(=O)N(C)c2ncn(CCO)c2C1=O |
| CAS DataBase Reference | 519-37-9(CAS DataBase Reference) |
Description and Uses
Cardiac analeptic;Phosphodiesterase inhibitor
Safety
| Symbol(GHS) | ![]() GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P301+P312+P330 |
| PPE | dust mask type N95 (US), Eyeshields, Gloves |
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 36-36/37-26 |
| WGK Germany | 3 |
| RTECS | XH5850000 |
| HS Code | 2939590000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Oral |





