A7002258
DL-NorepinephrineHydrochloride , 10mMinDMSO , 55-27-6
Synonym(s):
(±)-1-(3,4-Dihydroxyphenyl)-2-aminoethanol hydrochloride;(±)-4-(2-Amino-1-hydroxyethyl)-1,2-benzenediol hydrochloride;DL -Arterenol hydrochloride;DL -Noradrenaline hydrochloride
CAS NO.:55-27-6
Empirical Formula: C8H12ClNO3
Molecular Weight: 205.64
MDL number: MFCD00012880
EINECS: 200-229-8
| Pack Size | Price | Stock | Quantity |
| 1ml | RMB159.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 140-144 °C (dec.) |
| storage temp. | 2-8°C |
| solubility | water: soluble50mg/mL, clear to slightly hazy, faintly yellow to brownish-yellow |
| form | crystalline |
| color | off-white to tan |
| Water Solubility | water: soluble 50mg/mL, clear to slightly hazy, faintly yellow to brownish-yellow |
| BRN | 3707003 |
| Stability: | Hygroscopic |
| InChI | InChI=1S/C8H11NO3.ClH/c9-4-8(12)5-1-2-6(10)7(11)3-5;/h1-3,8,10-12H,4,9H2;1H |
| InChIKey | FQTFHMSZCSUVEU-UHFFFAOYSA-N |
| SMILES | C1(C(O)CN)C=CC(O)=C(O)C=1.Cl |
| CAS DataBase Reference | 55-27-6(CAS DataBase Reference) |
Description and Uses
Antagonist of dibutyryl cyclic AMP in the regulation of narcosis. Norepinephrine modulates human dendritic cell activation by altering cytokine release
Safety
| Symbol(GHS) | ![]() GHS06 |
| Signal word | Danger |
| Hazard statements | H301 |
| Precautionary statements | P301+P310 |
| PPE | Eyeshields, Faceshields, Gloves, type P2 (EN 143) respirator cartridges |
| Hazard Codes | T |
| Risk Statements | 25 |
| Safety Statements | 36/37/39-45 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | DN6650000 |
| F | 10 |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral |
| Toxicity | LDLo scu-rat: 2 mg/kg JPETAB 71,62,41 |






